EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35NO16 |
| Net Charge | 0 |
| Average Mass | 545.491 |
| Monoisotopic Mass | 545.19558 |
| SMILES | CC(=O)N[C@H]1[C@H](O[C@H]2[C@@H](O)[C@@H](CO)OC(O)[C@@H]2O)O[C@H](CO)[C@H](O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H]1O |
| InChI | InChI=1S/C20H35NO16/c1-5(25)21-9-12(28)16(36-20-14(30)13(29)10(26)6(2-22)34-20)8(4-24)35-19(9)37-17-11(27)7(3-23)33-18(32)15(17)31/h6-20,22-24,26-32H,2-4H2,1H3,(H,21,25)/t6-,7-,8-,9-,10+,11+,12-,13+,14-,15-,16+,17+,18?,19+,20-/m1/s1 |
| InChIKey | VGVHVNDLCYSGNE-XOGYUZJNSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-Galp-(1→4)-β-D-GalpNAc-(1→3)-D-Galp (CHEBI:60928) has role epitope (CHEBI:53000) |
| α-D-Galp-(1→4)-β-D-GalpNAc-(1→3)-D-Galp (CHEBI:60928) is a amino trisaccharide (CHEBI:59266) |
| α-D-Galp-(1→4)-β-D-GalpNAc-(1→3)-D-Galp (CHEBI:60928) is a galactosamine oligosaccharide (CHEBI:22484) |
| IUPAC Name |
|---|
| α-D-galactopyranosyl-(1→4)-2-acetamido-2-deoxy-β-D-galactopyranosyl-(1→3)-D-galactopyranose |
| Synonyms | Source |
|---|---|
| Gal-α-1→4-GalNAc-β-1→3-Gal | ChEBI |
| Galα1-4GalNAcβ1-3Gal | ChEBI |
| NOR-tri | ChEBI |
| α-D-Gal-(1→4)-β-D-GalNAc-(1→3)-D-Gal | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9310401 | Reaxys |
| Citations |
|---|