EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O6S |
| Net Charge | 0 |
| Average Mass | 383.426 |
| Monoisotopic Mass | 383.11511 |
| SMILES | [H][C@@]1([C@H](NC(=O)[C@H](N)c2ccc(O)cc2)C(=O)O)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C16H21N3O6S/c1-16(2)11(15(24)25)19-13(26-16)10(14(22)23)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,13,19-20H,17H2,1-2H3,(H,18,21)(H,22,23)(H,24,25)/t9-,10+,11+,13-/m1/s1 |
| InChIKey | LHHKJQFIKHAUIA-MPPDQPJWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicilloic acid (CHEBI:60912) has role allergen (CHEBI:50904) |
| amoxicilloic acid (CHEBI:60912) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| amoxicilloic acid (CHEBI:60912) is conjugate acid of amoxicilloate (CHEBI:133943) |
| Incoming Relation(s) |
| amoxicilloate (CHEBI:133943) is conjugate base of amoxicilloic acid (CHEBI:60912) |
| IUPAC Name |
|---|
| (2R,4S)-2-[(R)-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}(carboxy)methyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5648314 | Reaxys |
| Citations |
|---|