EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:60900 - 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer)
| Formula | C12H16N4O7 |
| Net Charge | 0 |
| Average Mass | 328.281 |
| Monoisotopic Mass | 328.10190 |
| SMILES | Cc1nc2c(=O)nc(=O)nc2n(C[C@H](O)[C@H](O)[C@H](O)CO)c1=O |
| InChI | InChI=1S/C12H16N4O7/c1-4-11(22)16(2-5(18)8(20)6(19)3-17)9-7(13-4)10(21)15-12(23)14-9/h5-6,8,17-20H,2-3H2,1H3,(H2,14,15,21,23)/t5-,6+,8-/m0/s1 |
| InChIKey | QCYVUUAIJUUUPI-BBVRLYRLSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.5.1.9 (riboflavin synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that inhibits the action of riboflavin synthase (EC 2.5.1.9). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer) (CHEBI:60900) has functional parent lumazine (CHEBI:16489) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer) (CHEBI:60900) has functional parent ribitol (CHEBI:15963) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer) (CHEBI:60900) has role EC 2.5.1.9 (riboflavin synthase) inhibitor (CHEBI:60901) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer) (CHEBI:60900) is a pteridines (CHEBI:26373) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer) (CHEBI:60900) is conjugate acid of 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer)(1−) (CHEBI:60501) |
| Incoming Relation(s) |
| 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer)(1−) (CHEBI:60501) is conjugate base of 6-methyl-7-oxo-8-(1-D-ribityl)lumazine (2-oxo tautomer) (CHEBI:60900) |
| IUPAC Name |
|---|
| 1-deoxy-1-(6-methyl-2,4,7-trioxo-1,3,4,7-tetrahydropteridin-8(2H)-yl)-D-ribitol |
| Synonym | Source |
|---|---|
| Photolumazine C | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:52634 | Reaxys |
| CAS:17879-89-9 | ChemIDplus |