EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO3 |
| Net Charge | 0 |
| Average Mass | 155.153 |
| Monoisotopic Mass | 155.05824 |
| SMILES | N[C@@H]1C(=O)CC=C[C@H]1C(=O)O |
| InChI | InChI=1S/C7H9NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-2,4,6H,3,8H2,(H,10,11)/t4-,6+/m1/s1 |
| InChIKey | AQGCSVBPRRQXIN-XINAWCOVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,6S)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60857) is a 6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60854) |
| (1R,6S)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60857) is enantiomer of (1S,6R)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60858) |
| (1R,6S)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60857) is tautomer of (1R,6S)-6-ammonio-5-oxocyclohex-2-ene-1-carboxylate (CHEBI:60862) |
| Incoming Relation(s) |
| trans-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60866) has part (1R,6S)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60857) |
| (1S,6R)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60858) is enantiomer of (1R,6S)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60857) |
| (1R,6S)-6-ammonio-5-oxocyclohex-2-ene-1-carboxylate (CHEBI:60862) is tautomer of (1R,6S)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid (CHEBI:60857) |
| IUPAC Name |
|---|
| (1R,6S)-6-amino-5-oxocyclohex-2-ene-1-carboxylic acid |
| Citations |
|---|