EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO3 |
| Net Charge | 0 |
| Average Mass | 155.153 |
| Monoisotopic Mass | 155.05824 |
| SMILES | [NH3+][C@@H]1C(C(=O)[O-])=CC=C[C@H]1O |
| InChI | InChI=1S/C7H9NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,5-6,9H,8H2,(H,10,11)/t5-,6-/m1/s1 |
| InChIKey | XBTXTLKLSHACSS-PHDIDXHHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3R)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60848) is a 2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60847) |
| (2R,3R)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60848) is enantiomer of (2S,3S)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60849) |
| (2R,3R)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60848) is tautomer of (2R,3R)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60843) |
| Incoming Relation(s) |
| trans-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60853) has part (2R,3R)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60848) |
| (2S,3S)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60849) is enantiomer of (2R,3R)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60848) |
| (2R,3R)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60843) is tautomer of (2R,3R)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60848) |
| IUPAC Name |
|---|
| (5R,6R)-6-ammonio-5-hydroxycyclohexa-1,3-diene-1-carboxylate |
| Synonym | Source |
|---|---|
| (2R,3R)-2-amino-2,3-dihydro-3-hydroxybenzoic acid zwitterion | ChEBI |