EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO3 |
| Net Charge | 0 |
| Average Mass | 155.153 |
| Monoisotopic Mass | 155.05824 |
| SMILES | N[C@@H]1C(C(=O)O)=CC=C[C@@H]1O |
| InChI | InChI=1S/C7H9NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,5-6,9H,8H2,(H,10,11)/t5-,6+/m0/s1 |
| InChIKey | XBTXTLKLSHACSS-NTSWFWBYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60840) is a 2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60841) |
| (2R,3S)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60840) is enantiomer of (2S,3R)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60842) |
| (2R,3S)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60840) is tautomer of (2R,3S)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60845) |
| Incoming Relation(s) |
| cis-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60850) has part (2R,3S)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60840) |
| (2S,3R)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60842) is enantiomer of (2R,3S)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60840) |
| (2R,3S)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion (CHEBI:60845) is tautomer of (2R,3S)-2,3-dihydro-3-hydroxyanthranilic acid (CHEBI:60840) |
| IUPAC Name |
|---|
| (5S,6R)-6-amino-5-hydroxycyclohexa-1,3-diene-1-carboxylic acid |
| Synonym | Source |
|---|---|
| (2R,3S)-2-amino-2,3-dihydro-3-hydroxybenzoic acid | ChEBI |