EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13NO3 |
| Net Charge | 0 |
| Average Mass | 291.306 |
| Monoisotopic Mass | 291.08954 |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C18H13NO3/c20-17(14-9-3-4-10-15(14)18(21)22)19-16-11-5-7-12-6-1-2-8-13(12)16/h1-11H,(H,19,20)(H,21,22) |
| InChIKey | JXTHEWSKYLZVJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naptalam (CHEBI:60833) has role herbicide (CHEBI:24527) |
| naptalam (CHEBI:60833) is a N-(1-naphthyl)carboxamide (CHEBI:88360) |
| naptalam (CHEBI:60833) is a carboxylic acid (CHEBI:33575) |
| naptalam (CHEBI:60833) is a dicarboxylic acid monoamide (CHEBI:35735) |
| naptalam (CHEBI:60833) is conjugate acid of naptalamate (CHEBI:62072) |
| Incoming Relation(s) |
| naptalamate (CHEBI:62072) is conjugate base of naptalam (CHEBI:60833) |
| IUPAC Name |
|---|
| 2-(naphthalen-1-ylcarbamoyl)benzoic acid |
| Synonyms | Source |
|---|---|
| NPA | SUBMITTER |
| α-naphthylphthalamic acid | SUBMITTER |
| 2-((1-naphthalenylamino)carbonyl)benzoic acid | ChemIDplus |
| N-α-naphthylphthalamic acid | ChemIDplus |
| N-1-naphthyl-phthalamidsäure | ChemIDplus |
| 1-N-naphthylphthalamic acid | ChemIDplus |