EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H63N12O10 |
| Net Charge | +5 |
| Average Mass | 763.919 |
| Monoisotopic Mass | 763.47627 |
| SMILES | [H][C@]12N/C(=[NH+]/[C@@H]3O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]3NC(=O)C[C@@H]([NH3+])CCCNC(=O)C[C@@H]([NH3+])CCCNC(=O)C[C@@H]([NH3+])CCC[NH3+])N[C@]1([H])[C@H](O)CNC2=O |
| InChI | InChI=1S/C31H58N12O10/c32-7-1-4-15(33)10-20(46)37-8-2-5-16(34)11-21(47)38-9-3-6-17(35)12-22(48)40-25-26(49)27(53-30(36)51)19(14-44)52-29(25)43-31-41-23-18(45)13-39-28(50)24(23)42-31/h15-19,23-27,29,44-45,49H,1-14,32-35H2,(H2,36,51)(H,37,46)(H,38,47)(H,39,50)(H,40,48)(H2,41,42,43)/p+5/t15-,16-,17-,18+,19+,23+,24-,25+,26-,27-,29+/m0/s1 |
| InChIKey | WUJTXMVGXDQPNN-OTQKCRDJSA-S |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptothricin D(5+) (CHEBI:60829) is a guanidinium ion (CHEBI:60251) |
| streptothricin D(5+) (CHEBI:60829) is a primary aliphatic ammonium ion (CHEBI:58001) |
| streptothricin D(5+) (CHEBI:60829) is conjugate acid of streptothricin D (CHEBI:60828) |
| Incoming Relation(s) |
| Nβ-acetylstreptothricin D(4+) (CHEBI:141396) has functional parent streptothricin D(5+) (CHEBI:60829) |
| streptothricin D (CHEBI:60828) is conjugate base of streptothricin D(5+) (CHEBI:60829) |
| IUPAC Name |
|---|
| (4S)-6-{[(4S)-4-ammonio-6-{[(4S)-4-ammonio-6-{[(2R,3R,4S,5R,6R)-5-(carbamoyloxy)-4-hydroxy-6-(hydroxymethyl)-2-{[(2E,3aS,7R,7aS)-7-hydroxy-4-oxooctahydro-2H-imidazo[4,5-c]pyridin-2-ylidene]ammonio}tetrahydro-2H-pyran-3-yl]amino}-6-oxohexyl]amino}-6-oxohexyl]amino}-6-oxohexane-1,4-diaminium |
| Synonyms | Source |
|---|---|
| antibiotic OP 2C(5+) | ChEBI |
| antibiotic OP 2C penta-cation | ChEBI |
| antibiotic OP 2C pentacation | ChEBI |
| racemomycin B(5+) | ChEBI |
| racemomycin B penta-cation | ChEBI |
| racemomycin B pentacation | ChEBI |
| UniProt Name | Source |
|---|---|
| streptothricin D | UniProt |
| Citations |
|---|