EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O4 |
| Net Charge | 0 |
| Average Mass | 240.259 |
| Monoisotopic Mass | 240.11101 |
| SMILES | N[C@@H](CCCn1c(C=O)ccc1CO)C(=O)O |
| InChI | InChI=1S/C11H16N2O4/c12-10(11(16)17)2-1-5-13-8(6-14)3-4-9(13)7-15/h3-4,6,10,15H,1-2,5,7,12H2,(H,16,17)/t10-/m0/s1 |
| InChIKey | UTUGCGABRJMXQS-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(L-norvalin-5-yl)pyrraline (CHEBI:60824) is a N-substituted pyrraline (CHEBI:131546) |
| 1-(L-norvalin-5-yl)pyrraline (CHEBI:60824) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 5-[2-formyl-5-(hydroxymethyl)-1H-pyrrol-1-yl]-L-norvaline |
| Synonyms | Source |
|---|---|
| ε-L-norlysyl pyrraline | ChEBI |
| ε-L-ornithyl pyrraline | ChEBI |
| Citations |
|---|