EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H37N8O8 |
| Net Charge | +3 |
| Average Mass | 505.553 |
| Monoisotopic Mass | 505.27179 |
| SMILES | [H][C@]12N/C(=[NH+]/[C@@H]3O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]3NC(=O)C[C@@H]([NH3+])CCC[NH3+])N[C@]1([H])[C@H](O)CNC2=O |
| InChI | InChI=1S/C19H34N8O8/c20-3-1-2-7(21)4-10(30)24-13-14(31)15(35-18(22)33)9(6-28)34-17(13)27-19-25-11-8(29)5-23-16(32)12(11)26-19/h7-9,11-15,17,28-29,31H,1-6,20-21H2,(H2,22,33)(H,23,32)(H,24,30)(H2,25,26,27)/p+3/t7-,8+,9+,11+,12-,13+,14-,15-,17+/m0/s1 |
| InChIKey | NRAUADCLPJTGSF-VLSXYIQESA-Q |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptothricin F(3+) (CHEBI:60822) has role antimicrobial agent (CHEBI:33281) |
| streptothricin F(3+) (CHEBI:60822) is a guanidinium ion (CHEBI:60251) |
| streptothricin F(3+) (CHEBI:60822) is a primary aliphatic ammonium ion (CHEBI:58001) |
| streptothricin F(3+) (CHEBI:60822) is conjugate acid of streptothricin F (CHEBI:60821) |
| Incoming Relation(s) |
| Nβ-acetylstreptothricin F(2+) (CHEBI:141394) has functional parent streptothricin F(3+) (CHEBI:60822) |
| streptothricin F (CHEBI:60821) is conjugate base of streptothricin F(3+) (CHEBI:60822) |
| IUPAC Name |
|---|
| (4S)-6-{[(2R,3R,4S,5R,6R)-5-(carbamoyloxy)-4-hydroxy-6-(hydroxymethyl)-2-{[(2E,3aS,7R,7aS)-7-hydroxy-4-oxooctahydro-2H-imidazo[4,5-c]pyridin-2-ylidene]ammonio}tetrahydro-2H-pyran-3-yl]amino}-6-oxohexane-1,4-diaminium |
| Synonyms | Source |
|---|---|
| antibiotic S 15-1A(3+) | ChEBI |
| antibiotic S 15-1A tri-cation | ChEBI |
| racemomycin A(3+) | ChEBI |
| racemomycin A tri-cation | ChEBI |
| streptothricin F tri-cation | ChEBI |
| streptothricin VI(3+) | ChEBI |
| UniProt Name | Source |
|---|---|
| streptothricin F | UniProt |
| Citations |
|---|