EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O4 |
| Net Charge | 0 |
| Average Mass | 318.328 |
| Monoisotopic Mass | 318.08921 |
| SMILES | O=C(Oc1ccccc1)c1ccccc1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H14O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h1-14H |
| InChIKey | DWNAQMUDCDVSLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenyl phthalate (CHEBI:60819) is a diester (CHEBI:51307) |
| diphenyl phthalate (CHEBI:60819) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| diphenyl benzene-1,2-dicarboxylate |
| Synonyms | Source |
|---|---|
| 1,2-Benzenedicarboxylic acid, 1,2-diphenyl ester | ChemIDplus |
| 1,2-Benzenedicarboxylic acid, diphenyl ester | SUBMITTER |
| diphenyl benzene-1,2-dicarboxylate | SUBMITTER |
| Phthalic acid, diphenyl ester | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| KR20100023676 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2473390 | Reaxys |
| CAS:84-62-8 | ChemIDplus |
| Citations |
|---|