EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:60805 - rolicyclidine
| Formula | C16H23N |
| Net Charge | 0 |
| Average Mass | 229.367 |
| Monoisotopic Mass | 229.18305 |
| SMILES | c1ccc(C2(N3CCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C16H23N/c1-3-9-15(10-4-1)16(11-5-2-6-12-16)17-13-7-8-14-17/h1,3-4,9-10H,2,5-8,11-14H2 |
| InChIKey | FYOWWXMGDATDQY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Applications: | general anaesthetic Substance that produces loss of consciousness. hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rolicyclidine (CHEBI:60805) has role general anaesthetic (CHEBI:38869) |
| rolicyclidine (CHEBI:60805) has role hallucinogen (CHEBI:35499) |
| rolicyclidine (CHEBI:60805) has role NMDA receptor antagonist (CHEBI:60643) |
| rolicyclidine (CHEBI:60805) is a pyrrolidines (CHEBI:38260) |
| rolicyclidine (CHEBI:60805) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 1-(1-phenylcyclohexyl)pyrrolidine |
| INNs | Source |
|---|---|
| rolicyclidinum | ChemIDplus |
| roliciclidina | ChemIDplus |
| rolicyclidine | ChemIDplus |
| Synonym | Source |
|---|---|
| PCPy | ChemIDplus |