EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28N2O |
| Net Charge | 0 |
| Average Mass | 288.435 |
| Monoisotopic Mass | 288.22016 |
| SMILES | CCCCN1CCCC[C@@H]1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21)/t16-/m1/s1 |
| InChIKey | LEBVLXFERQHONN-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextrobupivacaine (CHEBI:60790) is a 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide (CHEBI:77431) |
| dextrobupivacaine (CHEBI:60790) is conjugate base of dextrobupivacaine(1+) (CHEBI:77459) |
| dextrobupivacaine (CHEBI:60790) is enantiomer of levobupivacaine (CHEBI:6149) |
| Incoming Relation(s) |
| bupivacaine (CHEBI:3215) has part dextrobupivacaine (CHEBI:60790) |
| dextrobupivacaine(1+) (CHEBI:77459) is conjugate acid of dextrobupivacaine (CHEBI:60790) |
| levobupivacaine (CHEBI:6149) is enantiomer of dextrobupivacaine (CHEBI:60790) |
| IUPAC Name |
|---|
| (2R)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
| Synonyms | Source |
|---|---|
| (R)-(+)-bupivacaine | ChEBI |
| D-bupivacaine | ChEBI |
| D-(+)-bupivacaine | ChemIDplus |
| (+)-bupivacaine | ChEBI |
| D-1-butyl-2',6'-pipecoloxylidide | ChEBI |
| D-(+)-1-butyl-2',6'-pipecoloxylidide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5382239 | Reaxys |
| CAS:27262-45-9 | ChemIDplus |
| Citations |
|---|