EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O5 |
| Net Charge | 0 |
| Average Mass | 148.114 |
| Monoisotopic Mass | 148.03717 |
| SMILES | [H][C@](O)(CO)[C@@]([H])(O)C(=O)C=O |
| WURCS | WURCS=2.0/1,1,0/[oO21h]/1/ |
| InChI | InChI=1S/C5H8O5/c6-1-3(8)5(10)4(9)2-7/h1,4-5,7,9-10H,2H2/t4-,5-/m0/s1 |
| InChIKey | VDSAQEDKJUSZPS-WHFBIAKZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-keto-L-xylose (CHEBI:60785) is a 2-keto-xylose (CHEBI:60786) |
| 2-keto-L-xylose (CHEBI:60785) is enantiomer of 2-keto-D-xylose (CHEBI:46675) |
| Incoming Relation(s) |
| 2-keto-D-xylose (CHEBI:46675) is enantiomer of 2-keto-L-xylose (CHEBI:60785) |
| IUPAC Name |
|---|
| L-threo-pentos-2-ulose |
| Synonyms | Source |
|---|---|
| L-lyxosone | ChEBI |
| (3R,4S)-3,4,5-trihydroxy-2-oxopentanal | ChEBI |
| L-threo-2-pentosulose | ChEBI |
| L-xylosone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723811 | Reaxys |
| Citations |
|---|