EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O9P |
| Net Charge | -2 |
| Average Mass | 322.166 |
| Monoisotopic Mass | 322.02131 |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](OP(=O)([O-])[O-])[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N2O9P/c12-3-4-7(20-21(16,17)18)6(14)8(19-4)11-2-1-5(13)10-9(11)15/h1-2,4,6-8,12,14H,3H2,(H,10,13,15)(H2,16,17,18)/p-2/t4-,6-,7-,8-/m1/s1 |
| InChIKey | FOGRQMPFHUHIGU-XVFCMESISA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-UMP(2−) (CHEBI:60784) has role human metabolite (CHEBI:77746) |
| 3'-UMP(2−) (CHEBI:60784) is a nucleoside 3'-phosphate(2−) (CHEBI:66949) |
| 3'-UMP(2−) (CHEBI:60784) is conjugate base of 3'-UMP (CHEBI:28895) |
| Incoming Relation(s) |
| 3'-UMP (CHEBI:28895) is conjugate acid of 3'-UMP(2−) (CHEBI:60784) |
| IUPAC Name |
|---|
| 3'-O-phosphonatouridine |
| Synonyms | Source |
|---|---|
| 3'-uridylate | IUPAC |
| uridine 3'-monophosphate | IUPAC |
| UniProt Name | Source |
|---|---|
| 3'-UMP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-3724 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3916201 | Reaxys |