EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H71O14R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 860.060 |
| Monoisotopic Mass (excl. R groups) | 859.48438 |
| SMILES | *C[C@H](C)[C@@]1([H])O[C@]2(CC[C@@H]1C)C[C@@H]1C[C@@]([H])(C/C=C(\C)[C@@H](O[C@H]3C[C@H](OC)[C@@H](O[C@H]4C[C@H](OC)[C@@H](O)[C@H](C)O4)[C@H](C)O3)[C@@H](C)/C=C/C=C3\CO[C@]4([H])[C@H](O)C(C)=C[C@@]([H])(C(=O)O1)[C@]34O)O2 |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | scabicide An acaricide that kills mites of the genus Sarcoptes. antinematodal drug A substance used in the treatment or control of nematode infestations. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. anthelminthic drug Substance intended to kill parasitic worms (helminths). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ivermectin (CHEBI:6078) has part 22,23-dihydroavermectin B1a (CHEBI:63941) |
| ivermectin (CHEBI:6078) has part 22,23-dihydroavermectin B1b (CHEBI:63943) |
| ivermectin (CHEBI:6078) has role anthelminthic drug (CHEBI:35443) |
| ivermectin (CHEBI:6078) has role antinematodal drug (CHEBI:35444) |
| ivermectin (CHEBI:6078) has role antiprotozoal drug (CHEBI:35820) |
| ivermectin (CHEBI:6078) has role insecticide (CHEBI:24852) |
| ivermectin (CHEBI:6078) has role scabicide (CHEBI:73333) |
| ivermectin (CHEBI:6078) is a mixture (CHEBI:60004) |
| INNs | Source |
|---|---|
| ivermectin | ChemIDplus |
| ivermectine | ChemIDplus |
| ivermectino | ChemIDplus |
| ivermectinum | ChemIDplus |
| Brand Names | Source |
|---|---|
| Ivermax | ChEBI |
| Ivomec | ChemIDplus |
| Mectizan | DrugBank |
| Noromectin | ChEBI |
| Privermectin | ChEBI |
| Sklice | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1455 | VSDB |
| 7988461 | ChemSpider |
| D00804 | KEGG DRUG |
| DB00602 | DrugBank |
| ivermectin | Alan Wood's Pesticides |
| Ivermectin | Wikipedia |
| US4199569 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:70288-86-7 | KEGG COMPOUND |
| CAS:70288-86-7 | ChemIDplus |
| Citations |
|---|