EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H71O14R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 860.060 |
| Monoisotopic Mass (excl. R groups) | 859.48438 |
| SMILES | *C[C@H](C)[C@@]1([H])O[C@]2(CC[C@@H]1C)C[C@@H]1C[C@@]([H])(C/C=C(\C)[C@@H](O[C@H]3C[C@H](OC)[C@@H](O[C@H]4C[C@H](OC)[C@@H](O)[C@H](C)O4)[C@H](C)O3)[C@@H](C)/C=C/C=C3\CO[C@]4([H])[C@H](O)C(C)=C[C@@]([H])(C(=O)O1)[C@]34O)O2 |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | scabicide An acaricide that kills mites of the genus Sarcoptes. antinematodal drug A substance used in the treatment or control of nematode infestations. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. anthelminthic drug Substance intended to kill parasitic worms (helminths). antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ivermectin (CHEBI:6078) has part 22,23-dihydroavermectin B1a (CHEBI:63941) |
| ivermectin (CHEBI:6078) has part 22,23-dihydroavermectin B1b (CHEBI:63943) |
| ivermectin (CHEBI:6078) has role anthelminthic drug (CHEBI:35443) |
| ivermectin (CHEBI:6078) has role antiinfective agent (CHEBI:35441) |
| ivermectin (CHEBI:6078) has role antileishmanial agent (CHEBI:70868) |
| ivermectin (CHEBI:6078) has role antimalarial (CHEBI:38068) |
| ivermectin (CHEBI:6078) has role antimicrobial agent (CHEBI:33281) |
| ivermectin (CHEBI:6078) has role antinematodal drug (CHEBI:35444) |
| ivermectin (CHEBI:6078) has role antineoplastic agent (CHEBI:35610) |
| ivermectin (CHEBI:6078) has role antiprotozoal drug (CHEBI:35820) |
| ivermectin (CHEBI:6078) has role antiviral agent (CHEBI:22587) |
| ivermectin (CHEBI:6078) has role dermatologic drug (CHEBI:50177) |
| ivermectin (CHEBI:6078) has role insecticide (CHEBI:24852) |
| ivermectin (CHEBI:6078) has role scabicide (CHEBI:73333) |
| ivermectin (CHEBI:6078) is a mixture (CHEBI:60004) |
| INNs | Source |
|---|---|
| ivermectin | ChemIDplus |
| ivermectina | WHO MedNet |
| ivermectine | ChemIDplus |
| ivermectino | ChemIDplus |
| ivermectinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 22,23-dihydroabamectin | ChEMBL |
| 22,23-dihydroavermectin b1 | ChEMBL |
| 22,23-dihydroavermectin b1a | ChEMBL |
| 22,23-dihydro c-076b1 | ChEMBL |
| Acarexx | ChEMBL |
| Bimectin | ChEMBL |
| Brand Names | Source |
|---|---|
| Heartguard | ChEMBL |
| Ivermax | ChEBI |
| Ivomec | ChemIDplus |
| Mectizan | DrugBank |
| Noromectin | ChEBI |
| Privermectin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1455 | VSDB |
| 7988461 | ChemSpider |
| D00804 | KEGG DRUG |
| DB00602 | DrugBank |
| ivermectin | Alan Wood's Pesticides |
| Ivermectin | Wikipedia |
| US4199569 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:70288-86-7 | ChemIDplus |
| CAS:70288-86-7 | KEGG COMPOUND |
| Citations |
|---|