EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11FN2O5 |
| Net Charge | 0 |
| Average Mass | 246.194 |
| Monoisotopic Mass | 246.06520 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1F |
| InChI | InChI=1S/C9H11FN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | ODKNJVUHOIMIIZ-RRKCRQDMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| floxuridine (CHEBI:60761) has role antimetabolite (CHEBI:35221) |
| floxuridine (CHEBI:60761) has role antineoplastic agent (CHEBI:35610) |
| floxuridine (CHEBI:60761) has role antiviral drug (CHEBI:36044) |
| floxuridine (CHEBI:60761) has role radiosensitizing agent (CHEBI:132992) |
| floxuridine (CHEBI:60761) is a nucleoside analogue (CHEBI:60783) |
| floxuridine (CHEBI:60761) is a organofluorine compound (CHEBI:37143) |
| floxuridine (CHEBI:60761) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| IUPAC Name |
|---|
| 5-fluoro-2'-deoxyuridine |
| INNs | Source |
|---|---|
| floxiridina | DrugBank |
| floxuridine | KEGG DRUG |
| floxuridinum | DrugBank |
| Synonyms | Source |
|---|---|
| 1-(2-Deoxy-beta-D-ribofuranosyl)-5-fluorouracil | ChemIDplus |
| 1-beta-D-2'-Deoxyribofuranosyl-5-flurouracil | ChemIDplus |
| 1beta-D-2'-Deoxyribofuranosyl-5-flurouracil | ChemIDplus |
| 2'-Deoxy-5-fluorouridine | ChemIDplus |
| 5FDU | DrugBank |
| 5-fluoro-2'-deoxyuridine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1184 | DrugCentral |
| C11736 | KEGG COMPOUND |
| D04197 | KEGG DRUG |
| DB00322 | DrugBank |
| Floxuridine | Wikipedia |
| HMDB0014467 | HMDB |
| LSM-5588 | LINCS |
| Citations |
|---|