EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H83NO9 |
| Net Charge | 0 |
| Average Mass | 770.146 |
| Monoisotopic Mass | 769.60678 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)N[C@@H](CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@H](O)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C44H83NO9/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-33-39(48)45-36(35-53-44-43(52)42(51)41(50)38(34-46)54-44)40(49)37(47)32-30-28-26-24-22-16-14-12-10-8-6-4-2/h11,13,17-18,36-38,40-44,46-47,49-52H,3-10,12,14-16,19-35H2,1-2H3,(H,45,48)/b13-11-,18-17-/t36-,37+,38+,40-,41-,42-,43+,44-/m0/s1 |
| InChIKey | WSXMIFGRYXQZQZ-ULOPOQRHSA-N |
| Roles Classification |
|---|
| Biological Roles: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-(α-D-galactopyranosyl)-N-icosa-11,14-dienoylphytosphingosine (CHEBI:60748) has functional parent α-D-galactose (CHEBI:28061) |
| 1-O-(α-D-galactopyranosyl)-N-icosa-11,14-dienoylphytosphingosine (CHEBI:60748) has role antigen (CHEBI:59132) |
| 1-O-(α-D-galactopyranosyl)-N-icosa-11,14-dienoylphytosphingosine (CHEBI:60748) is a glycophytoceramide (CHEBI:59389) |
| IUPAC Name |
|---|
| (11Z,14Z)-N-[(2S,3S,4R)-1-(α-D-galactopyranosyloxy)-3,4-dihydroxyoctadecan-2-yl]icosa-11,14-dienamide |
| Synonyms | Source |
|---|---|
| Galα-Cer(t18:0/20:2) | ChEBI |
| α-GalCer (C20:2) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US52316 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11628406 | Reaxys |
| Citations |
|---|