EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6073 - Isradipine
| Formula | C19H21N3O5 |
| Net Charge | 0 |
| Average Mass | 371.393 |
| Monoisotopic Mass | 371.14812 |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1c1cccc2nonc12 |
| InChI | InChI=1S/C19H21N3O5/c1-9(2)26-19(24)15-11(4)20-10(3)14(18(23)25-5)16(15)12-7-6-8-13-17(12)22-27-21-13/h6-9,16,20H,1-5H3 |
| InChIKey | HMJIYCCIJYRONP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiparkinson drug A drug used in the treatment of Parkinson's disease. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isradipine (CHEBI:6073) has role antihypertensive agent (CHEBI:35674) |
| Isradipine (CHEBI:6073) has role antiparkinson drug (CHEBI:48407) |
| Isradipine (CHEBI:6073) has role antipsychotic agent (CHEBI:35476) |
| Isradipine (CHEBI:6073) has role cardiovascular drug (CHEBI:35554) |
| Isradipine (CHEBI:6073) is a benzoxadiazole (CHEBI:46829) |
| Isradipine (CHEBI:6073) is a dihydropyridine (CHEBI:50075) |
| Isradipine (CHEBI:6073) is a isopropyl ester (CHEBI:35725) |
| Isradipine (CHEBI:6073) is a methyl ester (CHEBI:25248) |
| Isradipine (CHEBI:6073) is a organic molecular entity (CHEBI:50860) |
| Isradipine (CHEBI:6073) is a racemate (CHEBI:60911) |
| INN | Source |
|---|---|
| isradipino | WHO MedNet |
| Synonyms | Source |
|---|---|
| DynaCirc (TN) | KEGG COMPOUND |
| dynacrine | DrugCentral |
| isradipin | DrugCentral |
| Isradipine | KEGG COMPOUND |
| isrodipine | DrugCentral |
| NSC-759892 | ChEMBL |
| Brand Names | Source |
|---|---|
| Dynacirc | ChEMBL |
| Dynacirc cr | ChEMBL |
| Prescal | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1511 | DrugCentral |
| D00349 | KEGG DRUG |
| HMDB0014415 | HMDB |
| LSM-1897 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:75695-93-1 | DrugCentral |
| CAS:75695-93-1 | KEGG COMPOUND |
| Citations |
|---|