EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O2 |
| Net Charge | 0 |
| Average Mass | 277.368 |
| Monoisotopic Mass | 277.17903 |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C15H23N3O2/c1-4-18(5-2)11-10-16-15(20)13-6-8-14(9-7-13)17-12(3)19/h6-9H,4-5,10-11H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | KEECCEWTUVWFCV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetylprocainamide (CHEBI:60728) has role anti-arrhythmia drug (CHEBI:38070) |
| N-acetylprocainamide (CHEBI:60728) is a acetamides (CHEBI:22160) |
| N-acetylprocainamide (CHEBI:60728) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| 4-acetamido-N-[2-(diethylamino)ethyl]benzamide |
| INNs | Source |
|---|---|
| acecainide | ChemIDplus |
| acecainidum | ChemIDplus |
| acecainida | ChemIDplus |
| Synonyms | Source |
|---|---|
| NAPA | ChemIDplus |
| 4'-((2-(Diethylamino)ethyl)carbamoyl)acetanilide | ChemIDplus |
| Acekainid | ChemIDplus |
| N-Acetyloprokainamid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2868559 | Reaxys |
| CAS:32795-44-1 | ChemIDplus |
| Citations |
|---|