EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H4F6O2 |
| Net Charge | 0 |
| Average Mass | 258.117 |
| Monoisotopic Mass | 258.01155 |
| SMILES | O=C(O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C9H4F6O2/c10-8(11,12)4-1-2-6(9(13,14)15)5(3-4)7(16)17/h1-3H,(H,16,17) |
| InChIKey | PINBPLCVZSKLTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-bis(trifluoromethyl)benzoic acid (CHEBI:60697) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| 2,5-bis(trifluoromethyl)benzoic acid (CHEBI:60697) is a benzoic acids (CHEBI:22723) |
| Incoming Relation(s) |
| 2,5-bis(trifluoromethyl)benzoyl group (CHEBI:60664) is substituent group from 2,5-bis(trifluoromethyl)benzoic acid (CHEBI:60697) |
| IUPAC Name |
|---|
| 2,5-bis(trifluoromethyl)benzoic acid |
| Synonym | Source |
|---|---|
| 2,5-bis(trifluoroformyl)benzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1989837 | Reaxys |