EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22O5 |
| Net Charge | 0 |
| Average Mass | 378.424 |
| Monoisotopic Mass | 378.14672 |
| SMILES | COc1c(Cc2ccccc2O)c(O)cc(O)c1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H22O5/c1-28-23-17(13-16-9-5-6-10-18(16)24)20(26)14-21(27)22(23)19(25)12-11-15-7-3-2-4-8-15/h2-10,14,24,26-27H,11-13H2,1H3 |
| InChIKey | WKYGVDYQMIWYES-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isouvaretin (CHEBI:6068) is a diarylheptanoid (CHEBI:78802) |
| Synonyms | Source |
|---|---|
| 1-(4,6-Dihydroxy-3-((2-hydroxyphenyl)methyl)-2-methoxyphenyl)-3-phenyl-1-propanone | KEGG COMPOUND |
| Isouvaretin | KEGG COMPOUND |