EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO3 |
| Net Charge | 0 |
| Average Mass | 311.381 |
| Monoisotopic Mass | 311.15214 |
| SMILES | [H][C@]12Cc3cccc(OC)c3-c3c(O)c(OC)cc(c31)CCN2C |
| InChI | InChI=1S/C19H21NO3/c1-20-8-7-12-10-15(23-3)19(21)18-16(12)13(20)9-11-5-4-6-14(22-2)17(11)18/h4-6,10,13,21H,7-9H2,1-3H3/t13-/m0/s1 |
| InChIKey | RQCOQZNIQLKGTN-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isothebaine (CHEBI:6066) has parent hydride aporphine (CHEBI:35643) |
| isothebaine (CHEBI:6066) is a aporphine alkaloid (CHEBI:134209) |
| IUPAC Names |
|---|
| 1-hydroxy-2,11-dimethoxyaporphine |
| (6aS)-2,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2,11-dimethoxyaporphine | ChemIDplus |
| 2,11-Dimethoxy-1-hydroxyaporphine | ChemIDplus |
| Isothebaine | KEGG COMPOUND |