EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N3O6 |
| Net Charge | 0 |
| Average Mass | 439.468 |
| Monoisotopic Mass | 439.17434 |
| SMILES | [H][C@@]1(COc2ccc(-c3ccc(C(=N)NC(=O)OC)cc3)cc2)C[C@@H](CC(=O)OC)C(=O)N1 |
| InChI | InChI=1S/C23H25N3O6/c1-30-20(27)12-17-11-18(25-22(17)28)13-32-19-9-7-15(8-10-19)14-3-5-16(6-4-14)21(24)26-23(29)31-2/h3-10,17-18H,11-13H2,1-2H3,(H,25,28)(H2,24,26,29)/t17-,18-/m0/s1 |
| InChIKey | PGCFXITVMNNKON-ROUUACIJSA-N |
| Roles Classification |
|---|
| Biological Role: | platelet glycoprotein-IIb/IIIa receptor antagonist Antagonist of platelet surface glycoprotein-IIb/IIIa which has a key role in hemostasis and thrombosis such as platelet adhesion and aggregation. |
| Applications: | platelet glycoprotein-IIb/IIIa receptor antagonist Antagonist of platelet surface glycoprotein-IIb/IIIa which has a key role in hemostasis and thrombosis such as platelet adhesion and aggregation. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lefradafiban (CHEBI:60634) has functional parent fradafiban (CHEBI:73266) |
| lefradafiban (CHEBI:60634) has role platelet glycoprotein-IIb/IIIa receptor antagonist (CHEBI:50433) |
| lefradafiban (CHEBI:60634) has role prodrug (CHEBI:50266) |
| lefradafiban (CHEBI:60634) is a methyl ester (CHEBI:25248) |
| lefradafiban (CHEBI:60634) is a pyrrolidin-2-ones (CHEBI:74223) |
| IUPAC Names |
|---|
| methyl {(3S,5S)-5-[({4'-[N-(methoxycarbonyl)carbamimidoyl]([1,1'-biphenyl]-4-yl)}oxy)methyl]-2-oxopyrrolidin-3-yl}acetate |
| methyl {(3S,5S)-5-[({4'-[N-(methoxycarbonyl)carbamimidoyl]biphenyl-4-yl}oxy)methyl]-2-oxopyrrolidin-3-yl}acetate |
| INNs | Source |
|---|---|
| lefradafiban | ChemIDplus |
| lefradafibán | WHO MedNet |
| léfradafiban | WHO MedNet |
| lefradafibanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (3S,5S)-5-[(4'-methoxycarbonylamidino-4-biphenylyl)-oxymethyl]-3-[(methoxycarbonyl)methyl]-2-pyrrolidinone | ChEBI |
| 3-pyrrolidineacetic acid, 5-[[[4'-[imino[(methoxycarbonyl) amino]methyl] [1,1'-biphenyl]-4-yl]oxy]methyl]-2-oxo-,methyl ester, (3S-trans) | ChEBI |
| FP-007SE | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14535302 | Reaxys |
| CAS:149503-79-7 | ChemIDplus |
| Citations |
|---|