EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:60631 - (S)-2-hydroxy-3-methylbutyric acid
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | CC(C)[C@H](O)C(=O)O |
| InChI | InChI=1S/C5H10O3/c1-3(2)4(6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | NGEWQZIDQIYUNV-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (18502700) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | chiral reagent A chiral compound used to induce stereoselectivity into a reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-hydroxy-3-methylbutyric acid (CHEBI:60631) has role chiral reagent (CHEBI:60646) |
| (S)-2-hydroxy-3-methylbutyric acid (CHEBI:60631) has role human metabolite (CHEBI:77746) |
| (S)-2-hydroxy-3-methylbutyric acid (CHEBI:60631) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| (S)-2-hydroxy-3-methylbutyric acid (CHEBI:60631) is conjugate acid of (S)-2-hydroxy-3-methylbutyrate (CHEBI:744019) |
| (S)-2-hydroxy-3-methylbutyric acid (CHEBI:60631) is enantiomer of (R)-2-hydroxy-3-methylbutyric acid (CHEBI:46415) |
| Incoming Relation(s) |
| (S)-2-hydroxy-3-methylbutyrate (CHEBI:744019) is conjugate base of (S)-2-hydroxy-3-methylbutyric acid (CHEBI:60631) |
| (R)-2-hydroxy-3-methylbutyric acid (CHEBI:46415) is enantiomer of (S)-2-hydroxy-3-methylbutyric acid (CHEBI:60631) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3-methylbutanoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-3-methyl-(S)-(+)-butyric acid | ChEBI |
| 2-Hydroxyisovalerate | SUBMITTER |
| 2-Oxyisovalerate | SUBMITTER |
| A-hydroxyisovaleric acid | SUBMITTER |
| (S)-(+)-2-hydroxy-3-methylbutanoic acid | ChEBI |
| (S)-(+)-2-hydroxy-3-methylbutyric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000407 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721140 | Reaxys |
| Citations |
|---|