EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO6 |
| Net Charge | 0 |
| Average Mass | 191.139 |
| Monoisotopic Mass | 191.04299 |
| SMILES | [H][C@]12OC[C@@H](O[N+](=O)[O-])[C@@]1([H])OC[C@@H]2O |
| InChI | InChI=1S/C6H9NO6/c8-3-1-11-6-4(13-7(9)10)2-12-5(3)6/h3-6,8H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | YWXYYJSYQOXTPL-SLPGGIOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isosorbide mononitrate (CHEBI:6062) has role nitric oxide donor (CHEBI:50566) |
| isosorbide mononitrate (CHEBI:6062) has role vasodilator agent (CHEBI:35620) |
| isosorbide mononitrate (CHEBI:6062) is a glucitol derivative (CHEBI:63433) |
| isosorbide mononitrate (CHEBI:6062) is a nitrate ester (CHEBI:51080) |
| IUPAC Name |
|---|
| 1,4:3,6-dianhydro-5-O-nitro-D-glucitol |
| INNs | Source |
|---|---|
| isosorbide mononitrate | ChemIDplus |
| isosorbidi mononitras | ChemIDplus |
| mononitrate d'isosorbide | ChemIDplus |
| mononitrato de isosorbida | ChemIDplus |
| Synonyms | Source |
|---|---|
| Isosorbide mononitrate | KEGG COMPOUND |
| Monosorbitrate | DrugBank |
| Brand Names | Source |
|---|---|
| Corangin | DrugBank |
| Duride | DrugBank |
| Elantan | DrugBank |
| Imdur | DrugBank |
| Imtrate | DrugBank |
| Ismexin | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5851319 | Beilstein |
| CAS:16051-77-7 | ChemIDplus |