EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6062 - isosorbide mononitrate
| Formula | C6H9NO6 |
| Net Charge | 0 |
| Average Mass | 191.139 |
| Monoisotopic Mass | 191.04299 |
| SMILES | [H][C@]12OC[C@@H](O[N+](=O)[O-])[C@@]1([H])OC[C@@H]2O |
| InChI | InChI=1S/C6H9NO6/c8-3-1-11-6-4(13-7(9)10)2-12-5(3)6/h3-6,8H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | YWXYYJSYQOXTPL-SLPGGIOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isosorbide mononitrate (CHEBI:6062) has role antihypertensive agent (CHEBI:35674) |
| isosorbide mononitrate (CHEBI:6062) has role cardiovascular drug (CHEBI:35554) |
| isosorbide mononitrate (CHEBI:6062) has role nitric oxide donor (CHEBI:50566) |
| isosorbide mononitrate (CHEBI:6062) has role vasodilator agent (CHEBI:35620) |
| isosorbide mononitrate (CHEBI:6062) is a glucitol derivative (CHEBI:63433) |
| isosorbide mononitrate (CHEBI:6062) is a nitrate ester (CHEBI:51080) |
| IUPAC Name |
|---|
| 1,4:3,6-dianhydro-5-O-nitro-D-glucitol |
| INNs | Source |
|---|---|
| isosorbide mononitrate | ChemIDplus |
| isosorbidi mononitras | ChemIDplus |
| mononitrate d'isosorbide | ChemIDplus |
| mononitrato de isosorbida | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,1-diureidisobutane | ChEMBL |
| AHR-4698 | ChEMBL |
| BM 22.145 | ChEMBL |
| BM-22-145 | ChEMBL |
| BM-22.145 | ChEMBL |
| BM-22145 | ChEMBL |
| Brand Names | Source |
|---|---|
| Angeze 10 | ChEMBL |
| Angeze 20 | ChEMBL |
| Angeze 40 | ChEMBL |
| Angeze sr 40 | ChEMBL |
| Angeze sr 60 | ChEMBL |
| Angitate | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5851319 | Beilstein |
| CAS:16051-77-7 | ChemIDplus |
| Citations |
|---|