EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6062 - isosorbide mononitrate
| Formula | C6H9NO6 |
| Net Charge | 0 |
| Average Mass | 191.139 |
| Monoisotopic Mass | 191.04299 |
| SMILES | [H][C@]12OC[C@@H](O[N+](=O)[O-])[C@@]1([H])OC[C@@H]2O |
| InChI | InChI=1S/C6H9NO6/c8-3-1-11-6-4(13-7(9)10)2-12-5(3)6/h3-6,8H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | YWXYYJSYQOXTPL-SLPGGIOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isosorbide mononitrate (CHEBI:6062) has role antihypertensive agent (CHEBI:35674) |
| isosorbide mononitrate (CHEBI:6062) has role cardiovascular drug (CHEBI:35554) |
| isosorbide mononitrate (CHEBI:6062) has role nitric oxide donor (CHEBI:50566) |
| isosorbide mononitrate (CHEBI:6062) has role vasodilator agent (CHEBI:35620) |
| isosorbide mononitrate (CHEBI:6062) is a glucitol derivative (CHEBI:63433) |
| isosorbide mononitrate (CHEBI:6062) is a nitrate ester (CHEBI:51080) |
| IUPAC Name |
|---|
| 1,4:3,6-dianhydro-5-O-nitro-D-glucitol |
| INNs | Source |
|---|---|
| isosorbide mononitrate | ChemIDplus |
| isosorbidi mononitras | ChemIDplus |
| mononitrate d'isosorbide | ChemIDplus |
| mononitrato de isosorbida | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,1-diureidisobutane | ChEMBL |
| AHR-4698 | ChEMBL |
| BM 22.145 | ChEMBL |
| BM-22-145 | ChEMBL |
| BM-22.145 | ChEMBL |
| BM-22145 | ChEMBL |
| Brand Names | Source |
|---|---|
| Angeze 10 | ChEMBL |
| Angeze 20 | ChEMBL |
| Angeze 40 | ChEMBL |
| Angeze sr 40 | ChEMBL |
| Angeze sr 60 | ChEMBL |
| Angitate | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5851319 | Beilstein |
| CAS:16051-77-7 | ChemIDplus |
| Citations |
|---|