EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30N3O3S.Cl |
| Net Charge | 0 |
| Average Mass | 536.097 |
| Monoisotopic Mass | 535.16964 |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(N=C=S)cc3C(=O)O)c3ccc(=[N+](CC)CC)cc-3oc2c1.[Cl-] |
| InChI | InChI=1S/C29H29N3O3S.ClH/c1-5-31(6-2)20-10-13-23-26(16-20)35-27-17-21(32(7-3)8-4)11-14-24(27)28(23)22-12-9-19(30-18-36)15-25(22)29(33)34;/h9-17H,5-8H2,1-4H3;1H |
| InChIKey | YVSWPCCVTYEEHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhodamine B 5-isothiocyanate (CHEBI:60608) has role fluorochrome (CHEBI:51217) |
| rhodamine B 5-isothiocyanate (CHEBI:60608) is a rhodamine B isothiocyanate (CHEBI:60604) |
| IUPAC Name |
|---|
| N-[9-(2-carboxy-4-isothiocyanatophenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride |
| Synonyms | Source |
|---|---|
| rhodamine B isothiocyanate 5-isomer | ChEBI |
| RITC | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10753432 | Beilstein |
| CAS:36877-69-7 | ChemIDplus |
| Citations |
|---|