EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O4 |
| Net Charge | 0 |
| Average Mass | 146.142 |
| Monoisotopic Mass | 146.05791 |
| SMILES | [H][C@]12OC[C@H](O)[C@@]1([H])OC[C@H]2O |
| InChI | InChI=1S/C6H10O4/c7-3-1-9-6-4(8)2-10-5(3)6/h3-8H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | KLDXJTOLSGUMSJ-JGWLITMVSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isosorbide (CHEBI:6060) has role antihypertensive agent (CHEBI:35674) |
| Isosorbide (CHEBI:6060) has role antineoplastic agent (CHEBI:35610) |
| Isosorbide (CHEBI:6060) has role cardiovascular drug (CHEBI:35554) |
| Isosorbide (CHEBI:6060) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| isosorbida | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,4:3,6-dianhydro-d-glucitol | ChEMBL |
| AT-101 | ChEMBL |
| D-glucitol, 1,4:3,6-dianhydro- | ChEMBL |
| (+)-D-Isosorbide | DrugCentral |
| isobide | DrugCentral |
| Isosorbide | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Ismotic | ChEMBL |
| Citations |
|---|