EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O7 |
| Net Charge | 0 |
| Average Mass | 302.283 |
| Monoisotopic Mass | 302.11140 |
| SMILES | C=C1CCO[C@]2([C@@H](O)[C@@](C)(O)CO)NC(=O)[C@@]1(O)NC2=O |
| InChI | InChI=1S/C12H18N2O7/c1-6-3-4-21-12(7(16)10(2,19)5-15)9(18)13-11(6,20)8(17)14-12/h7,15-16,19-20H,1,3-5H2,2H3,(H,13,18)(H,14,17)/t7-,10-,11+,12-/m0/s1 |
| InChIKey | WOUDXEYYJPOSNE-VKZDFBPFSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bicozamycin (CHEBI:60584) has role antibacterial agent (CHEBI:33282) |
| bicozamycin (CHEBI:60584) has role antidiarrhoeal drug (CHEBI:55323) |
| bicozamycin (CHEBI:60584) has role antiinfective agent (CHEBI:35441) |
| bicozamycin (CHEBI:60584) is a azabicycloalkane (CHEBI:38295) |
| bicozamycin (CHEBI:60584) is a bridged compound (CHEBI:35990) |
| IUPAC Name |
|---|
| (1S,6R)-6-hydroxy-5-methylidene-1-[(1S,2S)-1,2,3-trihydroxy-2-methylpropyl]-2-oxa-7,9-diazabicyclo[4.2.2]decane-8,10-dione |
| INNs | Source |
|---|---|
| bicozamycinum | ChemIDplus |
| bicozamicina | ChemIDplus |
| bicozamycine | ChemIDplus |
| bicozamycin | ChemIDplus |
| Synonyms | Source |
|---|---|
| Bicozamycin | KEGG COMPOUND |
| Bicyclomycin | KEGG COMPOUND |
| aizumycin | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:566286 | Reaxys |
| CAS:38129-37-2 | KEGG COMPOUND |
| CAS:38129-37-2 | ChemIDplus |