EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H78NO10P |
| Net Charge | 0 |
| Average Mass | 788.057 |
| Monoisotopic Mass | 787.53633 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C42H78NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(44)50-35-38(36-51-54(48,49)52-37-39(43)42(46)47)53-41(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,38-39H,3-16,21-37,43H2,1-2H3,(H,46,47)(H,48,49)/b19-17-,20-18-/t38-,39+/m1/s1 |
| InChIKey | WTBFLCSPLLEDEM-JIDRGYQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dioleoyl-sn-glycero-3-phospho-L-serine (CHEBI:60568) has functional parent oleic acid (CHEBI:16196) |
| 1,2-dioleoyl-sn-glycero-3-phospho-L-serine (CHEBI:60568) has role mouse metabolite (CHEBI:75771) |
| 1,2-dioleoyl-sn-glycero-3-phospho-L-serine (CHEBI:60568) is a phosphatidylserine(18:1/18:1) (CHEBI:90437) |
| 1,2-dioleoyl-sn-glycero-3-phospho-L-serine (CHEBI:60568) is conjugate acid of 1,2-dioleoyl-sn-glycero-3-phospho-L-serine(1−) (CHEBI:74905) |
| Incoming Relation(s) |
| 1,2-dioleoyl-sn-glycero-3-phospho-L-serine(1−) (CHEBI:74905) is conjugate base of 1,2-dioleoyl-sn-glycero-3-phospho-L-serine (CHEBI:60568) |
| IUPAC Name |
|---|
| O-[({(2R)-2,3-bis[(9Z)-octadec-9-enoyloxy]propyl}oxy)(hydroxy)phosphoryl]-L-serine |
| Synonyms | Source |
|---|---|
| 1,2-Dioleoylphosphatidylserine | ChemIDplus |
| 1,2-Dioleoyl-sn-glycero-3-phosphoserine | ChemIDplus |
| 1,2-Dlps | ChemIDplus |
| Dioleoyl phosphatidylserine | ChemIDplus |
| DOPS | ChEBI |
| DOPSE | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012390 | HMDB |
| LMGP03010030 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8382796 | Reaxys |
| CAS:70614-14-1 | ChemIDplus |
| Citations |
|---|