EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H65N13O11S2 |
| Net Charge | 0 |
| Average Mass | 1040.240 |
| Monoisotopic Mass | 1039.43679 |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N1)C(=O)NCC(N)=O |
| InChI | InChI=1S/C46H65N13O11S2/c47-18-8-7-14-29(40(64)52-23-38(51)62)54-45(69)35-15-9-19-59(35)46(70)34-25-72-71-24-28(48)39(63)55-31(20-26-10-3-1-4-11-26)43(67)56-32(21-27-12-5-2-6-13-27)42(66)53-30(16-17-36(49)60)41(65)57-33(22-37(50)61)44(68)58-34/h1-6,10-13,28-35H,7-9,14-25,47-48H2,(H2,49,60)(H2,50,61)(H2,51,62)(H,52,64)(H,53,66)(H,54,69)(H,55,63)(H,56,67)(H,57,65)(H,58,68)/t28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 |
| InChIKey | SFKQVVDKFKYTNA-DZCXQCEKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | vasopressin receptor agonist Any drug which binds to vasopressin receptors and triggers a response. |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. vasopressin receptor agonist Any drug which binds to vasopressin receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| felypressin (CHEBI:60564) has role vasoconstrictor agent (CHEBI:50514) |
| felypressin (CHEBI:60564) has role vasopressin receptor agonist (CHEBI:59727) |
| felypressin (CHEBI:60564) is a heterodetic cyclic peptide (CHEBI:24533) |
| IUPAC Name |
|---|
| 1-{[(4R,7S,10S,13S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13,16-dibenzyl-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-lysylglycinamide |
| INNs | Source |
|---|---|
| felipresina | ChemIDplus |
| felypressin | ChemIDplus |
| felypressine | ChemIDplus |
| felypressinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(L-phenylalanine)-8-L-lysinevasopressin | ChemIDplus |
| Phe2-Lys8-vasopressin | ChEBI |
| PLV-2 | ChEBI |
| L-cysteinyl-L-phenylalanyl-L-phenylalanyl-L-glutaminyl-L-asparaginyl-L-cysteinyl-L-prolyl-L-lysylglycinamide cyclic (1-6)disulfide | ChemIDplus |
| Citations |
|---|