EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N3O3 |
| Net Charge | 0 |
| Average Mass | 262.289 |
| Monoisotopic Mass | 262.11917 |
| SMILES | *N=Nc1cccc(C(=O)NC(CC(C)C)C(=O)O)c1 |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(leucinocarbonyl)phenylazo group (CHEBI:60548) has role allergen (CHEBI:50904) |
| 3-(leucinocarbonyl)phenylazo group (CHEBI:60548) is a phenylazo groups (CHEBI:64638) |
| Synonyms | Source |
|---|---|
| m-azobenzoyl-leucine | ChEBI |
| m-azobenzoylleucine | ChEBI |
| m-azobenzoyl-DL-leucine | ChEBI |
| Citations |
|---|