EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO2 |
| Net Charge | 0 |
| Average Mass | 177.203 |
| Monoisotopic Mass | 177.07898 |
| SMILES | [H]C(=O)CNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO2/c12-7-6-11-10(13)8-9-4-2-1-3-5-9/h1-5,7H,6,8H2,(H,11,13) |
| InChIKey | ZBDOVHVJWVWSPQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzylpenilloaldehyde (CHEBI:60542) has functional parent acetaldehyde (CHEBI:15343) |
| benzylpenilloaldehyde (CHEBI:60542) has functional parent phenylacetic acid (CHEBI:30745) |
| benzylpenilloaldehyde (CHEBI:60542) has role allergen (CHEBI:50904) |
| benzylpenilloaldehyde (CHEBI:60542) is a amino aldehyde (CHEBI:22492) |
| IUPAC Name |
|---|
| N-(2-oxoethyl)-2-phenylacetamide |
| Synonyms | Source |
|---|---|
| benzylpenicilloaldehyde | ChEBI |
| G-penicilloaldehyde | ChEBI |
| G-penilloaldehyde | ChEBI |
| penicilloaldehyde | ChEBI |
| penilloaldehyde | ChEBI |
| phenyl-acetic acid-(2-oxo-ethylamide) | ChEBI |
| Citations |
|---|