EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H46N6NiO13 |
| Net Charge | -4 |
| Average Mass | 901.552 |
| Monoisotopic Mass | 900.24982 |
| SMILES | C[C@@]12CC(=O)N[C@@]13C[C@H]1[C@@H](CCC(=O)[O-])[C@](C)(CC(N)=O)C4=[N+]1[Ni-2]15[N]6C(=CC(=[N+]31)[C@H]2CCC(=O)[O-])[C@@H](CC(=O)[O-])[C@H](CCC(=O)[O-])C6=C1C(=O)CC[C@@H]2C1=[N+]5[C@H](C4)[C@H]2CC(=O)[O-] |
| InChI | InChI=1S/C42H52N6O13.Ni/c1-40(16-30(43)50)22(5-9-33(54)55)27-15-42-41(2,17-31(51)48-42)23(6-10-34(56)57)26(47-42)13-24-20(11-35(58)59)19(4-8-32(52)53)39(45-24)37-28(49)7-3-18-21(12-36(60)61)25(46-38(18)37)14-29(40)44-27;/h13,18-23,25,27H,3-12,14-17H2,1-2H3,(H9,43,45,46,47,48,49,50,51,52,53,54,55,56,57,58,59,60,61);/q;+2/p-6/t18-,19-,20-,21-,22+,23+,25+,27-,40-,41-,42-;/m0./s1 |
| InChIKey | XLFIRMYGVLUNOY-SXMZNAGASA-H |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme F430(4−) (CHEBI:60540) has role cofactor (CHEBI:23357) |
| coenzyme F430(4−) (CHEBI:60540) is a pentacarboxylic acid anion (CHEBI:35755) |
| coenzyme F430(4−) (CHEBI:60540) is conjugate base of coenzyme F430 (CHEBI:28265) |
| Incoming Relation(s) |
| coenzyme F430 (CHEBI:28265) is conjugate acid of coenzyme F430(4−) (CHEBI:60540) |
| Synonyms | Source |
|---|---|
| coenzyme F430 tetraanion | ChEBI |
| F(430) tetraanion | ChEBI |
| factor F430(4−) | ChEBI |
| factor F430 tetraanion | ChEBI |
| UniProt Name | Source |
|---|---|
| coenzyme F430 | UniProt |