EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O |
| Net Charge | 0 |
| Average Mass | 206.289 |
| Monoisotopic Mass | 206.14191 |
| SMILES | CC(C)c1ccc(NC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C12H18N2O/c1-9(2)10-5-7-11(8-6-10)13-12(15)14(3)4/h5-9H,1-4H3,(H,13,15) |
| InChIKey | PUIYMUZLKQOUOZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoproturon (CHEBI:6049) has role agrochemical (CHEBI:33286) |
| isoproturon (CHEBI:6049) has role environmental contaminant (CHEBI:78298) |
| isoproturon (CHEBI:6049) has role herbicide (CHEBI:24527) |
| isoproturon (CHEBI:6049) has role xenobiotic (CHEBI:35703) |
| isoproturon (CHEBI:6049) is a 3-(3,4-substituted-phenyl)-1,1-dimethylurea (CHEBI:157693) |
| IUPAC Name |
|---|
| 1,1-dimethyl-3-[4-(propan-2-yl)phenyl]urea |
| Synonyms | Source |
|---|---|
| 1,1-dimethyl-3-(p-isopropylphenyl)-urea | NIST Chemistry WebBook |
| 3-p-cumenyl-1,1-dimethylurea | Alan Wood's Pesticides |
| N-4-isopropylphenyl-N,N-dimethylurea | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| isoproturon | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 409 | PPDB |
| C11005 | KEGG COMPOUND |
| CPD-23253 | MetaCyc |
| isoproturon | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2214033 | Reaxys |
| CAS:34123-59-6 | KEGG COMPOUND |
| CAS:34123-59-6 | NIST Chemistry WebBook |
| CAS:34123-59-6 | ChemIDplus |
| Citations |
|---|