EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H80O10 |
| Net Charge | 0 |
| Average Mass | 757.103 |
| Monoisotopic Mass | 756.57515 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)OC(=O)CCCCCCCCCCCCCCC |
| InChI | InChI=1S/C43H80O10/c1-3-5-7-9-11-13-15-17-18-20-21-23-25-27-29-31-38(45)50-34-36(35-51-43-42(49)41(48)40(47)37(33-44)53-43)52-39(46)32-30-28-26-24-22-19-16-14-12-10-8-6-4-2/h17-18,36-37,40-44,47-49H,3-16,19-35H2,1-2H3/b18-17-/t36-,37+,40-,41-,42+,43-/m0/s1 |
| InChIKey | JBZBYHKCRFIXBI-CLELBICESA-N |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-oleoyl-3-O-palmitoyl-1-O-α-D-galactosyl-sn-glycerol (CHEBI:60453) has role antigen (CHEBI:59132) |
| 2-O-oleoyl-3-O-palmitoyl-1-O-α-D-galactosyl-sn-glycerol (CHEBI:60453) is a 2,3-diacyl-1-α-D-galactosyl-sn-glycerol (CHEBI:63763) |
| IUPAC Name |
|---|
| (2R)-3-(α-D-galactopyranosyloxy)-2-(hexadecanoyloxy)propyl (9Z)-octadec-9-enoate |
| Synonyms | Source |
|---|---|
| 1-O-α-D-galactosyl-2-O-oleoyl-3-O-palmitoyl-sn-glycerol | ChEBI |
| 1-O-α-D-Galp-3-O-Ole-2-O-Pal-sn-GRO | ChEBI |
| BbGL-2c | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3ILQ | PDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21669293 | Reaxys |
| Citations |
|---|