EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N5O8S2 |
| Net Charge | 0 |
| Average Mass | 436.448 |
| Monoisotopic Mass | 436.05968 |
| SMILES | *C(=O)[C@@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c1csc(N)n1)[C@H](C)NS(=O)(=O)O |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aztreonyl group (CHEBI:60429) has role allergen (CHEBI:50904) |
| aztreonyl group (CHEBI:60429) is a univalent carboacyl group (CHEBI:27207) |
| aztreonyl group (CHEBI:60429) is substituent group from aztreonam (CHEBI:161680) |
| Incoming Relation(s) |
| aztreonyl-L-lysine (CHEBI:139368) has part aztreonyl group (CHEBI:60429) |
| IUPAC Name |
|---|
| (2S,3S)-2-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-3-(sulfoamino)butanoyl |
| Synonym | Source |
|---|---|
| aztreonyl | ChEBI |
| Citations |
|---|