EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H79NO8 |
| Net Charge | 0 |
| Average Mass | 702.071 |
| Monoisotopic Mass | 701.58057 |
| SMILES | CCCCCCCCCCCCCCCC(=O)N[C@@H](COC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CCCCCCCCCCCCCCC |
| InChI | InChI=1S/C40H79NO8/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34(43)33(32-48-40-39(47)38(46)37(45)35(31-42)49-40)41-36(44)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h33-35,37-40,42-43,45-47H,3-32H2,1-2H3,(H,41,44)/t33-,34+,35+,37-,38-,39+,40?/m0/s1 |
| InChIKey | BLGKYYVFGMKTEZ-QVCIKPHISA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-galactosyl-N-hexadecanoylsphinganine (CHEBI:60408) has role hapten (CHEBI:59174) |
| D-galactosyl-N-hexadecanoylsphinganine (CHEBI:60408) is a glycodihydroceramide (CHEBI:60451) |
| IUPAC Name |
|---|
| N-[(2S,3S)-1-(D-galactopyranosyloxy)-3-hydroxyoctadecan-2-yl]hexadecanamide |
| Synonyms | Source |
|---|---|
| N-palmitoyldihyrogalactocerebroside | ChEBI |
| Gal-16 | ChEBI |
| D-galactosyl-N-palmitoylsphinganine | ChEBI |
| Citations |
|---|