EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O5 |
| Net Charge | 0 |
| Average Mass | 192.211 |
| Monoisotopic Mass | 192.09977 |
| SMILES | CO[C@@H]1[C@@H](OC)[C@@H](O)[C@H](O)O[C@H]1C |
| InChI | InChI=1S/C8H16O5/c1-4-6(11-2)7(12-3)5(9)8(10)13-4/h4-10H,1-3H3/t4-,5+,6-,7-,8+/m0/s1 |
| InChIKey | BTLHIWBHHPKNFQ-GWVFRZDISA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-di-O-methyl-α-L-rhamnose (CHEBI:60398) has functional parent α-L-rhamnopyranose (CHEBI:27907) |
| 3,4-di-O-methyl-α-L-rhamnose (CHEBI:60398) has role epitope (CHEBI:53000) |
| 3,4-di-O-methyl-α-L-rhamnose (CHEBI:60398) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 3,4-di-O-methyl-α-L-rhamnopyranose |
| Synonyms | Source |
|---|---|
| 6-deoxy-3,4-di-O-methyl-α-L-mannopyranose | IUPAC |
| 6-deoxy-O3,O4-dimethyl-α-L-mannopyranose | ChEBI |
| O3,O4-dimethyl-α-L-6-deoxymannopyranose | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2354336 | Reaxys |
| Citations |
|---|