EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4 |
| Net Charge | 0 |
| Average Mass | 176.172 |
| Monoisotopic Mass | 176.07971 |
| SMILES | C[C@@H]([NH3+])C(=O)N[C@H](CO)C(=O)[O-] |
| InChI | InChI=1S/C6H12N2O4/c1-3(7)5(10)8-4(2-9)6(11)12/h3-4,9H,2,7H2,1H3,(H,8,10)(H,11,12)/t3-,4-/m1/s1 |
| InChIKey | IPWKGIFRRBGCJO-QWWZWVQMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-alanyl-D-serine zwitterion (CHEBI:60390) is a dipeptide zwitterion (CHEBI:90799) |
| D-alanyl-D-serine zwitterion (CHEBI:60390) is tautomer of D-alanyl-D-serine (CHEBI:60467) |
| Incoming Relation(s) |
| D-alanyl-D-serine (CHEBI:60467) is tautomer of D-alanyl-D-serine zwitterion (CHEBI:60390) |
| IUPAC Name |
|---|
| N-[(2R)-2-azaniumylpropanoyl]-D-serinate |
| UniProt Name | Source |
|---|---|
| D-alanyl-D-serine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1921071 | Gmelin |
| Citations |
|---|