EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25O7P2 |
| Net Charge | -3 |
| Average Mass | 379.306 |
| Monoisotopic Mass | 379.10920 |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/p-3/b14-9-,15-11- |
| InChIKey | VWFJDQUYCIWHTN-FBXUGWQNSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cis,6-cis-farnesyl diphosphate(3−) (CHEBI:60374) is a organophosphate oxoanion (CHEBI:58945) |
| 2-cis,6-cis-farnesyl diphosphate(3−) (CHEBI:60374) is conjugate base of 2-cis,6-cis-farnesyl diphosphate (CHEBI:19511) |
| Incoming Relation(s) |
| 2-cis,6-cis-farnesyl diphosphate (CHEBI:19511) is conjugate acid of 2-cis,6-cis-farnesyl diphosphate(3−) (CHEBI:60374) |
| IUPAC Name |
|---|
| (2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl diphosphate |
| Synonym | Source |
|---|---|
| 2-cis,6-cis-farnesyl diphosphate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| (2Z,6Z)-farnesyl diphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9444 | MetaCyc |