EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O2 |
| Net Charge | 0 |
| Average Mass | 204.229 |
| Monoisotopic Mass | 204.08988 |
| SMILES | CCN1C(=O)N[C@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C11H12N2O2/c1-2-13-10(14)9(12-11(13)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,12,15)/t9-/m1/s1 |
| InChIKey | SZQIFWWUIBRPBZ-SECBINFHSA-N |
| Roles Classification |
|---|
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-ethotoin (CHEBI:60359) is a ethotoin (CHEBI:4888) |
| (R)-ethotoin (CHEBI:60359) is enantiomer of (S)-ethotoin (CHEBI:60360) |
| Incoming Relation(s) |
| (S)-ethotoin (CHEBI:60360) is enantiomer of (R)-ethotoin (CHEBI:60359) |
| IUPAC Name |
|---|
| (5R)-3-ethyl-5-phenylimidazolidine-2,4-dione |
| Synonyms | Source |
|---|---|
| (5R)-3-ethyl-5-phenylhydantoin | ChEBI |
| (R)-(−)-ethotoin | ChEBI |
| (−)-ethotoin | ChEBI |
| Citations |
|---|