EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O8 |
| Net Charge | -4 |
| Average Mass | 416.386 |
| Monoisotopic Mass | 416.12416 |
| SMILES | Cc1nc(Cc2ncc(CCC(=O)[O-])c2CC(=O)[O-])c(CCC(=O)[O-])c1CC(=O)[O-] |
| InChI | InChI=1S/C20H24N2O8/c1-10-13(6-19(27)28)12(3-5-18(25)26)16(22-10)8-15-14(7-20(29)30)11(9-21-15)2-4-17(23)24/h9,21-22H,2-8H2,1H3,(H,23,24)(H,25,26)(H,27,28)(H,29,30)/p-4 |
| InChIKey | LCAXMKQKEYTFDM-UHFFFAOYSA-J |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipyrromethane cofactor(4−) (CHEBI:60342) has role cofactor (CHEBI:23357) |
| dipyrromethane cofactor(4−) (CHEBI:60342) is a tetracarboxylic acid anion (CHEBI:35754) |
| dipyrromethane cofactor(4−) (CHEBI:60342) is conjugate base of dipyrromethane cofactor (CHEBI:42121) |
| Incoming Relation(s) |
| dipyrromethane cofactor (CHEBI:42121) is conjugate acid of dipyrromethane cofactor(4−) (CHEBI:60342) |
| IUPAC Names |
|---|
| 3,8-bis(carboxylatomethyl)-9-methyldipyrromethane-2,7-dipropionate |
| 3,8-bis(carboxylatomethyl)-9-methyl-5,10-dihydrodipyrrin-2,7-dipropionate |
| Synonyms | Source |
|---|---|
| dipyrromethane cofactor tetraanion | ChEBI |
| dipyrromethane cofactor tetracarboxylate | ChEBI |
| UniProt Name | Source |
|---|---|
| dipyrromethane | UniProt |