EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N6O3 |
| Net Charge | 0 |
| Average Mass | 474.565 |
| Monoisotopic Mass | 474.23794 |
| SMILES | CCOc1cc(N2CCC(O)CC2)ccc1Nc1ncc2c(n1)N(C)c1ccccc1C(=O)N2C |
| InChI | InChI=1S/C26H30N6O3/c1-4-35-23-15-17(32-13-11-18(33)12-14-32)9-10-20(23)28-26-27-16-22-24(29-26)30(2)21-8-6-5-7-19(21)25(34)31(22)3/h5-10,15-16,18,33H,4,11-14H2,1-3H3,(H,27,28,29) |
| InChIKey | QAPAJIZPZGWAND-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XMD8-92 (CHEBI:60325) has role protein kinase inhibitor (CHEBI:37699) |
| XMD8-92 (CHEBI:60325) is a pyrimidobenzodiazepine (CHEBI:60326) |
| IUPAC Name |
|---|
| 2-{[2-ethoxy-4-(4-hydroxypiperidin-1-yl)phenyl]amino}-5,11-dimethyl-5,11-dihydro-6H-pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| Manual Xrefs | Databases |
|---|---|
| LSM-1094 | LINCS |
| Citations |
|---|