EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N3O |
| Net Charge | 0 |
| Average Mass | 137.142 |
| Monoisotopic Mass | 137.05891 |
| SMILES | NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C6H7N3O/c7-9-6(10)5-1-3-8-4-2-5/h1-4H,7H2,(H,9,10) |
| InChIKey | QRXWMOHMRWLFEY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. drug allergen Any drug which causes the onset of an allergic reaction. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoniazide (CHEBI:6030) has functional parent isonicotinic acid (CHEBI:6032) |
| isoniazide (CHEBI:6030) has role anti-HIV agent (CHEBI:64946) |
| isoniazide (CHEBI:6030) has role anti-ulcer drug (CHEBI:49201) |
| isoniazide (CHEBI:6030) has role antimicrobial agent (CHEBI:33281) |
| isoniazide (CHEBI:6030) has role antineoplastic agent (CHEBI:35610) |
| isoniazide (CHEBI:6030) has role antitubercular agent (CHEBI:33231) |
| isoniazide (CHEBI:6030) has role drug allergen (CHEBI:88188) |
| isoniazide (CHEBI:6030) is a carbohydrazide (CHEBI:35363) |
| Incoming Relation(s) |
| N'-acetylisoniazid (CHEBI:7207) has functional parent isoniazide (CHEBI:6030) |
| IUPAC Name |
|---|
| pyridine-4-carbohydrazide |
| INN | Source |
|---|---|
| isoniazida | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-pyridinecarbohydrazide | ChEBI |
| Armazide | ChEMBL |
| Atcotibine | ChEMBL |
| Cedin | ChEMBL |
| Cotinazin | ChEMBL |
| Dianicotyl | ChEMBL |
| Brand Names | Source |
|---|---|
| Dow-isoniazid | ChEMBL |
| Hyzyd | ChEMBL |
| Inh | ChEMBL |
| Isoniazid component of rifamate | ChEMBL |
| Isoniazid component of rifater | ChEMBL |
| Laniazid | ChEMBL |
| UniProt Name | Source |
|---|---|
| isoniazid | UniProt |
| Citations |
|---|