EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6030 - isoniazide
| Formula | C6H7N3O |
| Net Charge | 0 |
| Average Mass | 137.142 |
| Monoisotopic Mass | 137.05891 |
| SMILES | NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C6H7N3O/c7-9-6(10)5-1-3-8-4-2-5/h1-4H,7H2,(H,9,10) |
| InChIKey | QRXWMOHMRWLFEY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. drug allergen Any drug which causes the onset of an allergic reaction. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. drug allergen Any drug which causes the onset of an allergic reaction. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoniazide (CHEBI:6030) has functional parent isonicotinic acid (CHEBI:6032) |
| isoniazide (CHEBI:6030) has role anti-HIV agent (CHEBI:64946) |
| isoniazide (CHEBI:6030) has role anti-ulcer drug (CHEBI:49201) |
| isoniazide (CHEBI:6030) has role antimicrobial agent (CHEBI:33281) |
| isoniazide (CHEBI:6030) has role antineoplastic agent (CHEBI:35610) |
| isoniazide (CHEBI:6030) has role antitubercular agent (CHEBI:33231) |
| isoniazide (CHEBI:6030) has role drug allergen (CHEBI:88188) |
| isoniazide (CHEBI:6030) is a carbohydrazide (CHEBI:35363) |
| Incoming Relation(s) |
| N'-acetylisoniazid (CHEBI:7207) has functional parent isoniazide (CHEBI:6030) |
| IUPAC Name |
|---|
| pyridine-4-carbohydrazide |
| INN | Source |
|---|---|
| isoniazida | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-pyridinecarbohydrazide | ChEBI |
| Armazide | ChEMBL |
| Atcotibine | ChEMBL |
| Cedin | ChEMBL |
| Cotinazin | ChEMBL |
| Dianicotyl | ChEMBL |
| Brand Names | Source |
|---|---|
| Dow-isoniazid | ChEMBL |
| Hyzyd | ChEMBL |
| Inh | ChEMBL |
| Isoniazid component of rifamate | ChEMBL |
| Isoniazid component of rifater | ChEMBL |
| Laniazid | ChEMBL |
| UniProt Name | Source |
|---|---|
| isoniazid | UniProt |
| Citations |
|---|