EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N3O |
| Net Charge | 0 |
| Average Mass | 137.142 |
| Monoisotopic Mass | 137.05891 |
| SMILES | NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C6H7N3O/c7-9-6(10)5-1-3-8-4-2-5/h1-4H,7H2,(H,9,10) |
| InChIKey | QRXWMOHMRWLFEY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoniazide (CHEBI:6030) has functional parent isonicotinic acid (CHEBI:6032) |
| isoniazide (CHEBI:6030) has role antitubercular agent (CHEBI:33231) |
| isoniazide (CHEBI:6030) has role drug allergen (CHEBI:88188) |
| isoniazide (CHEBI:6030) is a carbohydrazide (CHEBI:35363) |
| Incoming Relation(s) |
| N'-acetylisoniazid (CHEBI:7207) has functional parent isoniazide (CHEBI:6030) |
| IUPAC Name |
|---|
| pyridine-4-carbohydrazide |
| Synonyms | Source |
|---|---|
| 4-pyridinecarbohydrazide | ChEBI |
| Isoniazid | KEGG COMPOUND |
| isonicotinic acid hydrazide | NIST Chemistry WebBook |
| isonicotinic hydrazide | ChEBI |
| isonicotinohydrazide | NIST Chemistry WebBook |
| isonicotinoylhydrazide | IUPAC |
| UniProt Name | Source |
|---|---|
| isoniazid | UniProt |
| Citations |
|---|