EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N5O4 |
| Net Charge | 0 |
| Average Mass | 335.364 |
| Monoisotopic Mass | 335.15935 |
| SMILES | C=C(C)CCNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21N5O4/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(5-21)24-15/h6-7,9,11-12,15,21-23H,1,3-5H2,2H3,(H,16,17,18)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | XKOPXXUOWZQFQE-SDBHATRESA-N |
| Roles Classification |
|---|
| Biological Role: | cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-isopentenyladenosine (CHEBI:60283) has role cytokinin (CHEBI:23530) |
| N6-isopentenyladenosine (CHEBI:60283) is a hydrocarbyladenosine (CHEBI:24909) |
| N6-isopentenyladenosine (CHEBI:60283) is a isoprenoid (CHEBI:24913) |
| IUPAC Name |
|---|
| N-(3-methylbut-3-en-1-yl)adenosine |
| Synonyms | Source |
|---|---|
| N-isopentenyladenosine | ChEBI |
| N6-(3-methylbut-3-enyl)adenosine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1229211 | Reaxys |
| Citations |
|---|