EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:60179 - α-D-galactosyl-(1→2)-α-D-galactose
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,2,1/[a2112h-1a_1-5]/1-1/a2-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3-6(16)8(18)10(11(20)21-3)23-12-9(19)7(17)5(15)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5+,6+,7+,8+,9-,10-,11+,12-/m1/s1 |
| InChIKey | HIWPGCMGAMJNRG-OBXYLZGFSA-N |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-galactosyl-(1→2)-α-D-galactose (CHEBI:60179) has role epitope (CHEBI:53000) |
| α-D-galactosyl-(1→2)-α-D-galactose (CHEBI:60179) is a α-D-Galp-(1→2)-D-Galp (CHEBI:59432) |
| IUPAC Name |
|---|
| α-D-galactopyranosyl-(1→2)-α-D-galactopyranose |
| Synonyms | Source |
|---|---|
| α-D-Gal-(1→2)-α-D-Gal | ChEBI |
| α-D-Galp-(1→2)-α-D-Galp | ChEBI |
| 2-O-α-D-galactopyranosyl-α-D-galactopyranose | IUPAC |
| Galα1→2Galα | ChEBI |
| Galα1-2Galα | ChEBI |