EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O3 |
| Net Charge | 0 |
| Average Mass | 162.189 |
| Monoisotopic Mass | 162.10044 |
| SMILES | NCC(O)CCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N2O3/c7-3-4(9)1-2-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11) |
| InChIKey | YSMODUONRAFBET-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxylysine (CHEBI:60175) is a hydroxylysine (CHEBI:86498) |
| 5-hydroxylysine (CHEBI:60175) is conjugate acid of 5-hydroxylysinate (CHEBI:62979) |
| 5-hydroxylysine (CHEBI:60175) is conjugate base of 5-hydroxylysinium (CHEBI:133574) |
| Incoming Relation(s) |
| erythro-5-hydroxy-L-lysine (CHEBI:18040) is a 5-hydroxylysine (CHEBI:60175) |
| threo-5-hydroxy-D-lysine (CHEBI:64316) is a 5-hydroxylysine (CHEBI:60175) |
| threo-5-hydroxy-L-lysine (CHEBI:64035) is a 5-hydroxylysine (CHEBI:60175) |
| 5-hydroxylysinium (CHEBI:133574) is conjugate acid of 5-hydroxylysine (CHEBI:60175) |
| 5-hydroxylysinate (CHEBI:62979) is conjugate base of 5-hydroxylysine (CHEBI:60175) |
| IUPAC Name |
|---|
| 5-hydroxylysine |
| Synonyms | Source |
|---|---|
| 2,6-diamino-5-hydroxyhexanoic acid | ChEBI |
| 5-hydroxy-2,6-diaminohexanoic acid | ChEBI |
| hydroxylysine | ChEBI |
| Hyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-7689 | MetaCyc |