EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | COc1ccc2oc3cc(O)cc(O)c3c(=O)c2c1 |
| InChI | InChI=1S/C14H10O5/c1-18-8-2-3-11-9(6-8)14(17)13-10(16)4-7(15)5-12(13)19-11/h2-6,15-16H,1H3 |
| InChIKey | FVIYCYAHKMJVJK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana lutea (ncbitaxon:38851) | - | PubMed (18064621) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isogentisin (CHEBI:6017) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| isogentisin (CHEBI:6017) has role plant metabolite (CHEBI:76924) |
| isogentisin (CHEBI:6017) is a aromatic ether (CHEBI:35618) |
| isogentisin (CHEBI:6017) is a polyphenol (CHEBI:26195) |
| isogentisin (CHEBI:6017) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3-dihydroxy-7-methoxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 1,3-Dihydroxy--7-methoxyxanthone | KEGG COMPOUND |
| Isogentisine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002957 | KNApSAcK |
| C10070 | KEGG COMPOUND |
| HMDB0030871 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:258402 | Reaxys |
| CAS:491-64-5 | ChemIDplus |
| CAS:491-64-5 | KEGG COMPOUND |
| Citations |
|---|