EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O14S |
| Net Charge | 0 |
| Average Mass | 422.361 |
| Monoisotopic Mass | 422.07303 |
| SMILES | O=S(=O)(O)O[C@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H22O14S/c13-1-3-5(15)7(17)9(19)11(23-3)25-12-10(26-27(20,21)22)8(18)6(16)4(2-14)24-12/h3-19H,1-2H2,(H,20,21,22)/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | WVFKPISWLUJJIJ-LIZSDCNHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α,α-trehalose-2-sulfate (CHEBI:60114) has functional parent α,α-trehalose (CHEBI:16551) |
| α,α-trehalose-2-sulfate (CHEBI:60114) is a trehalose sulfate (CHEBI:60117) |
| α,α-trehalose-2-sulfate (CHEBI:60114) is conjugate acid of α,α-trehalose-2-sulfate(1−) (CHEBI:60091) |
| Incoming Relation(s) |
| α,α-trehalose-2-sulfate(1−) (CHEBI:60091) is conjugate base of α,α-trehalose-2-sulfate (CHEBI:60114) |
| IUPAC Name |
|---|
| 2-O-sulfo-α-D-glucopyranosyl α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2-O-Sulfotrehalose | ChemIDplus |
| 2-Sulfotrehalose | ChemIDplus |
| Trehalose 2-sulfate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1668481 | Beilstein |
| CAS:141923-45-7 | ChemIDplus |